C16H29NO3 — CID 123712413
tert-butyl 4-hydroxy-4-methyl-2-(2-methylidenebutyl)piperidine-1-carboxylate (PubChem CID 123712413) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-methyl-2-(2-methylidenebutyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-methyl-2-(2-methylidenebutyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123712413 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl 4-hydroxy-4-methyl-2-(2-methylidenebutyl)piperidine-1-carboxylate |
| SMILES | C=C(CC)CC1CC(C)(O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO3/c1-7-12(2)10-13-11-16(6,19)8-9-17(13)14(18)20-15(3,4)5/h13,19H,2,7-11H2,1,3-6H3 |
| InChIKey | ZZQVYHIBHBBKKA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|