C16H27NO3 — CID 123485732
tert-butyl 4-hydroxy-4-methyl-2-(2-methylidenebut-3-enyl)piperidine-1-carboxylate (PubChem CID 123485732) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-methyl-2-(2-methylidenebut-3-enyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-methyl-2-(2-methylidenebut-3-enyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123485732 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tert-butyl 4-hydroxy-4-methyl-2-(2-methylidenebut-3-enyl)piperidine-1-carboxylate |
| SMILES | C=CC(=C)CC1CC(C)(O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO3/c1-7-12(2)10-13-11-16(6,19)8-9-17(13)14(18)20-15(3,4)5/h7,13,19H,1-2,8-11H2,3-6H3 |
| InChIKey | RFSOWXRVSQJIEH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|