C13H18N2O3S — CID 171954566
3-(2,4-dimethoxypyrimidin-5-yl)-8-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171954566) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-(2,4-dimethoxypyrimidin-5-yl)-8-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2,4-dimethoxypyrimidin-5-yl)-8-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171954566 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(2,4-dimethoxypyrimidin-5-yl)-8-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1ncc(C2(O)CC3CCC(C2)S3)c(OC)n1 |
| InChI | InChI=1S/C13H18N2O3S/c1-17-11-10(7-14-12(15-11)18-2)13(16)5-8-3-4-9(6-13)19-8/h7-9,16H,3-6H2,1-2H3 |
| InChIKey | DGHZPIFHZRGXKR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |