C14H19NO2S — CID 171957733
3-(6-methoxy-2-pyridinyl)-9-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171957733) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-(6-methoxy-2-pyridinyl)-9-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(6-methoxy-2-pyridinyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171957733 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-(6-methoxy-2-pyridinyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | COc1cccc(C2(O)CC3CCCC(C2)S3)n1 |
| InChI | InChI=1S/C14H19NO2S/c1-17-13-7-3-6-12(15-13)14(16)8-10-4-2-5-11(9-14)18-10/h3,6-7,10-11,16H,2,4-5,8-9H2,1H3 |
| InChIKey | FBZZFTVXDKQHHO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |