C33H36N2O4 — CID 171957289
9H-fluoren-9-ylmethyl 3-hydroxy-3-(4-morpholin-4-ylphenyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171957289) has the molecular formula C33H36N2O4 and a molecular weight of 524.66 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-hydroxy-3-(4-morpholin-4-ylphenyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-hydroxy-3-(4-morpholin-4-ylphenyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171957289 |
| Molecular Formula | C33H36N2O4 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-hydroxy-3-(4-morpholin-4-ylphenyl)-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1C2CCCC1CC(O)(c1ccc(N3CCOCC3)cc1)C2 |
| InChI | InChI=1S/C33H36N2O4/c36-32(39-22-31-29-10-3-1-8-27(29)28-9-2-4-11-30(28)31)35-25-6-5-7-26(35)21-33(37,20-25)23-12-14-24(15-13-23)34-16-18-38-19-17-34/h1-4,8-15,25-26,31,37H,5-7,16-22H2 |
| InChIKey | OBOFTPXRLJYZFL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|