C22H28N2O4 — CID 171957302
tert-butyl 3-hydroxy-3-(2-methoxyquinolin-6-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171957302) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(2-methoxyquinolin-6-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(2-methoxyquinolin-6-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171957302 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(2-methoxyquinolin-6-yl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COc1ccc2cc(C3(O)CC4CCC(C3)N4C(=O)OC(C)(C)C)ccc2n1 |
| InChI | InChI=1S/C22H28N2O4/c1-21(2,3)28-20(25)24-16-7-8-17(24)13-22(26,12-16)15-6-9-18-14(11-15)5-10-19(23-18)27-4/h5-6,9-11,16-17,26H,7-8,12-13H2,1-4H3 |
| InChIKey | OWDZMRSHCVRXDN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |