C21H26N2O — CID 171957894
8-benzyl-3-(2,6-dimethyl-3-pyridinyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171957894) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 8-benzyl-3-(2,6-dimethyl-3-pyridinyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-benzyl-3-(2,6-dimethyl-3-pyridinyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171957894 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 8-benzyl-3-(2,6-dimethyl-3-pyridinyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | Cc1ccc(C2(O)CC3CCC(C2)N3Cc2ccccc2)c(C)n1 |
| InChI | InChI=1S/C21H26N2O/c1-15-8-11-20(16(2)22-15)21(24)12-18-9-10-19(13-21)23(18)14-17-6-4-3-5-7-17/h3-8,11,18-19,24H,9-10,12-14H2,1-2H3 |
| InChIKey | BDLOENWREHUGIT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |