C14H19NO2S — CID 171960175
8-oxo-3-(2-pyridin-2-ylethyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171960175) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 8-oxo-3-(2-pyridin-2-ylethyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-oxo-3-(2-pyridin-2-ylethyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171960175 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 8-oxo-3-(2-pyridin-2-ylethyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1C2CCC1CC(O)(CCc1ccccn1)C2 |
| InChI | InChI=1S/C14H19NO2S/c16-14(7-6-11-3-1-2-8-15-11)9-12-4-5-13(10-14)18(12)17/h1-3,8,12-13,16H,4-7,9-10H2 |
| InChIKey | NQVAFSLANFGGKC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |