C18H21NO3S — CID 171962757
3-(8-methylquinolin-7-yl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171962757) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-(8-methylquinolin-7-yl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(8-methylquinolin-7-yl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171962757 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-(8-methylquinolin-7-yl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | Cc1c(C2(O)CC3CCCC(C2)S3(=O)=O)ccc2cccnc12 |
| InChI | InChI=1S/C18H21NO3S/c1-12-16(8-7-13-4-3-9-19-17(12)13)18(20)10-14-5-2-6-15(11-18)23(14,21)22/h3-4,7-9,14-15,20H,2,5-6,10-11H2,1H3 |
| InChIKey | LLELANKLBHUIES-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |