C31H32FNO5 — CID 171963622
9H-fluoren-9-ylmethyl 3-[2-fluoro-4-(methoxymethoxy)phenyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171963622) has the molecular formula C31H32FNO5 and a molecular weight of 517.60 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 3-[2-fluoro-4-(methoxymethoxy)phenyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 3-[2-fluoro-4-(methoxymethoxy)phenyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171963622 |
| Molecular Formula | C31H32FNO5 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 3-[2-fluoro-4-(methoxymethoxy)phenyl]-3-hydroxy-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | COCOc1ccc(C2(O)CC3CCCC(C2)N3C(=O)OCC2c3ccccc3-c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C31H32FNO5/c1-36-19-38-22-13-14-28(29(32)15-22)31(35)16-20-7-6-8-21(17-31)33(20)30(34)37-18-27-25-11-4-2-9-23(25)24-10-3-5-12-26(24)27/h2-5,9-15,20-21,27,35H,6-8,16-19H2,1H3 |
| InChIKey | QGEFCMUZYHTFIM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|