C14H14F5NO2 — CID 171963925
9-methyl-7-(2,3,4,5,6-pentafluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol (PubChem CID 171963925) has the molecular formula C14H14F5NO2 and a molecular weight of 323.26 g/mol. Its IUPAC name is 9-methyl-7-(2,3,4,5,6-pentafluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol.
| Compound Name | 9-methyl-7-(2,3,4,5,6-pentafluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
|---|---|
| PubChem CID | 171963925 |
| Molecular Formula | C14H14F5NO2 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 9-methyl-7-(2,3,4,5,6-pentafluorophenyl)-3-oxa-9-azabicyclo[3.3.1]nonan-7-ol |
| SMILES | CN1C2COCC1CC(O)(c1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C14H14F5NO2/c1-20-6-2-14(21,3-7(20)5-22-4-6)8-9(15)11(17)13(19)12(18)10(8)16/h6-7,21H,2-5H2,1H3 |
| InChIKey | MDABPBSCVKLADJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|