C26H23NO2S — CID 171967380
3-(4-carbazol-9-ylphenyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (PubChem CID 171967380) has the molecular formula C26H23NO2S and a molecular weight of 413.54 g/mol. Its IUPAC name is 3-(4-carbazol-9-ylphenyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
| Compound Name | 3-(4-carbazol-9-ylphenyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
|---|---|
| PubChem CID | 171967380 |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 3-(4-carbazol-9-ylphenyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| SMILES | O=S1(=O)C2C=C(c3ccc(-n4c5ccccc5c5ccccc54)cc3)CC1CCC2 |
| InChI | InChI=1S/C26H23NO2S/c28-30(29)21-6-5-7-22(30)17-19(16-21)18-12-14-20(15-13-18)27-25-10-3-1-8-23(25)24-9-2-4-11-26(24)27/h1-4,8-16,21-22H,5-7,17H2 |
| InChIKey | AHJGUSSDDQJDQX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |