C23H21F4NO2 — CID 171967473
benzyl 3-[2-fluoro-3-(trifluoromethyl)phenyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171967473) has the molecular formula C23H21F4NO2 and a molecular weight of 419.42 g/mol. Its IUPAC name is benzyl 3-[2-fluoro-3-(trifluoromethyl)phenyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | benzyl 3-[2-fluoro-3-(trifluoromethyl)phenyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171967473 |
| Molecular Formula | C23H21F4NO2 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | benzyl 3-[2-fluoro-3-(trifluoromethyl)phenyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2C=C(c3cccc(C(F)(F)F)c3F)CC1CCC2 |
| InChI | InChI=1S/C23H21F4NO2/c24-21-19(10-5-11-20(21)23(25,26)27)16-12-17-8-4-9-18(13-16)28(17)22(29)30-14-15-6-2-1-3-7-15/h1-3,5-7,10-12,17-18H,4,8-9,13-14H2 |
| InChIKey | MBAMEKUMEHEBDG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |