C25H27NO3 — CID 171967713
tert-butyl 3-dibenzofuran-4-yl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171967713) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl 3-dibenzofuran-4-yl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-dibenzofuran-4-yl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171967713 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl 3-dibenzofuran-4-yl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(c3cccc4c3oc3ccccc34)CC1CCC2 |
| InChI | InChI=1S/C25H27NO3/c1-25(2,3)29-24(27)26-17-8-6-9-18(26)15-16(14-17)19-11-7-12-21-20-10-4-5-13-22(20)28-23(19)21/h4-5,7,10-14,17-18H,6,8-9,15H2,1-3H3 |
| InChIKey | CVFIMBCJMAERPZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |