C22H26N2O2 — CID 171969979
tert-butyl 3-isoquinolin-4-yl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171969979) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl 3-isoquinolin-4-yl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-isoquinolin-4-yl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969979 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl 3-isoquinolin-4-yl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(c3cncc4ccccc34)CC1CCC2 |
| InChI | InChI=1S/C22H26N2O2/c1-22(2,3)26-21(25)24-17-8-6-9-18(24)12-16(11-17)20-14-23-13-15-7-4-5-10-19(15)20/h4-5,7,10-11,13-14,17-18H,6,8-9,12H2,1-3H3 |
| InChIKey | LMISTACTKGTXHC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |