C22H21F4NO — CID 171968220
9-benzyl-7-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene (PubChem CID 171968220) has the molecular formula C22H21F4NO and a molecular weight of 391.41 g/mol. Its IUPAC name is 9-benzyl-7-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 9-benzyl-7-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 171968220 |
| Molecular Formula | C22H21F4NO |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 9-benzyl-7-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
| SMILES | Fc1cc(CC2=CC3COCC(C2)N3Cc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F4NO/c23-19-8-16(7-18(11-19)22(24,25)26)6-17-9-20-13-28-14-21(10-17)27(20)12-15-4-2-1-3-5-15/h1-5,7-9,11,20-21H,6,10,12-14H2 |
| InChIKey | FBNDAGYBKHTLLK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|