C21H18F5NO — CID 171968218
9-benzyl-7-[(2,3,4,5,6-pentafluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene (PubChem CID 171968218) has the molecular formula C21H18F5NO and a molecular weight of 395.37 g/mol. Its IUPAC name is 9-benzyl-7-[(2,3,4,5,6-pentafluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 9-benzyl-7-[(2,3,4,5,6-pentafluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 171968218 |
| Molecular Formula | C21H18F5NO |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 9-benzyl-7-[(2,3,4,5,6-pentafluorophenyl)methyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
| SMILES | Fc1c(F)c(F)c(CC2=CC3COCC(C2)N3Cc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C21H18F5NO/c22-17-16(18(23)20(25)21(26)19(17)24)8-13-6-14-10-28-11-15(7-13)27(14)9-12-4-2-1-3-5-12/h1-6,14-15H,7-11H2 |
| InChIKey | KNBJEVBAQKKNIE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|