C21H30N4O2 — CID 171969463
tert-butyl 3-(2-pyrrolidin-1-ylpyrimidin-5-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171969463) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is tert-butyl 3-(2-pyrrolidin-1-ylpyrimidin-5-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-(2-pyrrolidin-1-ylpyrimidin-5-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171969463 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | tert-butyl 3-(2-pyrrolidin-1-ylpyrimidin-5-yl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(c3cnc(N4CCCC4)nc3)CC1CCC2 |
| InChI | InChI=1S/C21H30N4O2/c1-21(2,3)27-20(26)25-17-7-6-8-18(25)12-15(11-17)16-13-22-19(23-14-16)24-9-4-5-10-24/h11,13-14,17-18H,4-10,12H2,1-3H3 |
| InChIKey | PVVWYKVWNJWYLI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |