C19H23N5O2 — CID 171969541
tert-butyl 3-(2-imidazol-1-ylpyrimidin-5-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171969541) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is tert-butyl 3-(2-imidazol-1-ylpyrimidin-5-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | tert-butyl 3-(2-imidazol-1-ylpyrimidin-5-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171969541 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | tert-butyl 3-(2-imidazol-1-ylpyrimidin-5-yl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(c3cnc(-n4ccnc4)nc3)CC1CC2 |
| InChI | InChI=1S/C19H23N5O2/c1-19(2,3)26-18(25)24-15-4-5-16(24)9-13(8-15)14-10-21-17(22-11-14)23-7-6-20-12-23/h6-8,10-12,15-16H,4-5,9H2,1-3H3 |
| InChIKey | LXZXWBKQKKLXOQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |