C21H22ClNO2 — CID 171971059
9-benzyl-7-(2-chloro-5-methoxyphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene (PubChem CID 171971059) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is 9-benzyl-7-(2-chloro-5-methoxyphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 9-benzyl-7-(2-chloro-5-methoxyphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 171971059 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 9-benzyl-7-(2-chloro-5-methoxyphenyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
| SMILES | COc1ccc(Cl)c(C2=CC3COCC(C2)N3Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H22ClNO2/c1-24-19-7-8-21(22)20(11-19)16-9-17-13-25-14-18(10-16)23(17)12-15-5-3-2-4-6-15/h2-9,11,17-18H,10,12-14H2,1H3 |
| InChIKey | BOHNFUCNWZWSAB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |