C19H18Cl2N2O — CID 171971757
9-benzyl-7-(2,5-dichloro-4-pyridinyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene (PubChem CID 171971757) has the molecular formula C19H18Cl2N2O and a molecular weight of 361.27 g/mol. Its IUPAC name is 9-benzyl-7-(2,5-dichloro-4-pyridinyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 9-benzyl-7-(2,5-dichloro-4-pyridinyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 171971757 |
| Molecular Formula | C19H18Cl2N2O |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 9-benzyl-7-(2,5-dichloro-4-pyridinyl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
| SMILES | Clc1cc(C2=CC3COCC(C2)N3Cc2ccccc2)c(Cl)cn1 |
| InChI | InChI=1S/C19H18Cl2N2O/c20-18-9-22-19(21)8-17(18)14-6-15-11-24-12-16(7-14)23(15)10-13-4-2-1-3-5-13/h1-6,8-9,15-16H,7,10-12H2 |
| InChIKey | YLJAJNJFPWWRKD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|