C19H20BrNS — CID 171973242
9-benzyl-3-(4-bromothiophen-3-yl)-9-azabicyclo[3.3.1]non-2-ene (PubChem CID 171973242) has the molecular formula C19H20BrNS and a molecular weight of 374.35 g/mol. Its IUPAC name is 9-benzyl-3-(4-bromothiophen-3-yl)-9-azabicyclo[3.3.1]non-2-ene.
| Compound Name | 9-benzyl-3-(4-bromothiophen-3-yl)-9-azabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 171973242 |
| Molecular Formula | C19H20BrNS |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 9-benzyl-3-(4-bromothiophen-3-yl)-9-azabicyclo[3.3.1]non-2-ene |
| SMILES | Brc1cscc1C1=CC2CCCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H20BrNS/c20-19-13-22-12-18(19)15-9-16-7-4-8-17(10-15)21(16)11-14-5-2-1-3-6-14/h1-3,5-6,9,12-13,16-17H,4,7-8,10-11H2 |
| InChIKey | CYLVWUOOLMHKAW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |