C15H18LiNO — CID 102525351
lithium 9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-olate (PubChem CID 102525351) has the molecular formula C15H18LiNO and a molecular weight of 235.26 g/mol. Its IUPAC name is lithium 9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-olate.
| Compound Name | lithium 9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-olate |
|---|---|
| PubChem CID | 102525351 |
| Molecular Formula | C15H18LiNO |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | lithium 9-benzyl-9-azabicyclo[3.3.1]non-2-en-3-olate |
| SMILES | [Li+].[O-]C1=CC2CCCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO.Li/c17-15-9-13-7-4-8-14(10-15)16(13)11-12-5-2-1-3-6-12;/h1-3,5-6,9,13-14,17H,4,7-8,10-11H2;/q;+1/p-1 |
| InChIKey | YMWALZONBYAEHQ-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |