C16H14F3NS — CID 171973970
4-(9-thiabicyclo[3.3.1]non-2-en-3-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 171973970) has the molecular formula C16H14F3NS and a molecular weight of 309.36 g/mol. Its IUPAC name is 4-(9-thiabicyclo[3.3.1]non-2-en-3-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(9-thiabicyclo[3.3.1]non-2-en-3-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171973970 |
| Molecular Formula | C16H14F3NS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-(9-thiabicyclo[3.3.1]non-2-en-3-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(C2=CC3CCCC(C2)S3)cc1C(F)(F)F |
| InChI | InChI=1S/C16H14F3NS/c17-16(18,19)15-8-10(4-5-11(15)9-20)12-6-13-2-1-3-14(7-12)21-13/h4-6,8,13-14H,1-3,7H2 |
| InChIKey | ZYSMKQUSTINKOR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |