C10H10ClN3O — CID 171977591
2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)ethanol (PubChem CID 171977591) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)ethanol.
| Compound Name | 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)ethanol |
|---|---|
| PubChem CID | 171977591 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)ethanol |
| SMILES | OC(Cc1ccc(Cl)cc1)n1cncn1 |
| InChI | InChI=1S/C10H10ClN3O/c11-9-3-1-8(2-4-9)5-10(15)14-7-12-6-13-14/h1-4,6-7,10,15H,5H2 |
| InChIKey | PSVLGFCXQZMZII-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |