C15H16N4O2S2 — CID 171977667
4,4-dimethyl-14-prop-2-enylsulfanyl-5-oxa-8-thia-10,12,13,15-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one (PubChem CID 171977667) has the molecular formula C15H16N4O2S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4,4-dimethyl-14-prop-2-enylsulfanyl-5-oxa-8-thia-10,12,13,15-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one.
| Compound Name | 4,4-dimethyl-14-prop-2-enylsulfanyl-5-oxa-8-thia-10,12,13,15-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
|---|---|
| PubChem CID | 171977667 |
| Molecular Formula | C15H16N4O2S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4,4-dimethyl-14-prop-2-enylsulfanyl-5-oxa-8-thia-10,12,13,15-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10,13-tetraen-16-one |
| SMILES | C=CCSc1n[nH]c2nc3sc4c(c3c(=O)n12)CC(C)(C)OC4 |
| InChI | InChI=1S/C15H16N4O2S2/c1-4-5-22-14-18-17-13-16-11-10(12(20)19(13)14)8-6-15(2,3)21-7-9(8)23-11/h4H,1,5-7H2,2-3H3,(H,16,17) |
| InChIKey | LKKQCYLLVRAXNJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|