C22H22N4OS3 — CID 22333425
7-benzylsulfanyl-14,14-dimethyl-5-prop-2-enylsulfanyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 22333425) has the molecular formula C22H22N4OS3 and a molecular weight of 454.65 g/mol. Its IUPAC name is 7-benzylsulfanyl-14,14-dimethyl-5-prop-2-enylsulfanyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 7-benzylsulfanyl-14,14-dimethyl-5-prop-2-enylsulfanyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 22333425 |
| Molecular Formula | C22H22N4OS3 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 7-benzylsulfanyl-14,14-dimethyl-5-prop-2-enylsulfanyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | C=CCSc1nnc2c3c4c(sc3nc(SCc3ccccc3)n12)COC(C)(C)C4 |
| InChI | InChI=1S/C22H22N4OS3/c1-4-10-28-21-25-24-18-17-15-11-22(2,3)27-12-16(15)30-19(17)23-20(26(18)21)29-13-14-8-6-5-7-9-14/h4-9H,1,10-13H2,2-3H3 |
| InChIKey | CJTNWIRCLUOCDO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|