C23H16FNO3 — CID 171978215
2-(4-fluorophenyl)-5-(2-phenylmethoxyphenyl)-1,3-oxazin-6-one (PubChem CID 171978215) has the molecular formula C23H16FNO3 and a molecular weight of 373.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(2-phenylmethoxyphenyl)-1,3-oxazin-6-one.
| Compound Name | 2-(4-fluorophenyl)-5-(2-phenylmethoxyphenyl)-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 171978215 |
| Molecular Formula | C23H16FNO3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(2-phenylmethoxyphenyl)-1,3-oxazin-6-one |
| SMILES | O=c1oc(-c2ccc(F)cc2)ncc1-c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H16FNO3/c24-18-12-10-17(11-13-18)22-25-14-20(23(26)28-22)19-8-4-5-9-21(19)27-15-16-6-2-1-3-7-16/h1-14H,15H2 |
| InChIKey | NBEFTCMFCDVWFJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |