About 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine
2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine (PubChem CID 175115317) has the molecular formula C21H18N2O2
and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine.
Molecular Properties
| Compound Name | 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine |
| PubChem CID | 175115317 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine |
| SMILES | c1ccc(COc2ccccc2-c2ncco2)cc1.c1ccncc1 |
| InChI | InChI=1S/C16H13NO2.C5H5N/c1-2-6-13(7-3-1)12-19-15-9-5-4-8-14(15)16-17-10-11-18-16;1-2-4-6-5-3-1/h1-11H,12H2;1-5H |
| InChIKey | ODGMVIYKYDKOJT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine?
The IUPAC name of 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine (CID 175115317) is 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine.
What is the SMILES notation for 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine?
The canonical SMILES for 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine is c1ccc(COc2ccccc2-c2ncco2)cc1.c1ccncc1.
What is the InChIKey of 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine?
The InChIKey is ODGMVIYKYDKOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2.C5H5N/c1-2-6-13(7-3-1)12-19-15-9-5-4-8-14(15)16-17-10-11-18-16;1-2-4-6-5-3-1/h1-11H,12H2;1-5H.
What are the key properties of 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine?
2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine has a molecular weight of 330.39 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylmethoxyphenyl)-1,3-oxazole;pyridine is sourced from PubChem (CID 175115317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).