C31H33FN2O2S — CID 171980556
2-(3,5-ditert-butyl-4-fluorophenyl)sulfonyl-1-(1H-indol-3-yl)-1H-isoquinoline (PubChem CID 171980556) has the molecular formula C31H33FN2O2S and a molecular weight of 516.68 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-fluorophenyl)sulfonyl-1-(1H-indol-3-yl)-1H-isoquinoline.
| Compound Name | 2-(3,5-ditert-butyl-4-fluorophenyl)sulfonyl-1-(1H-indol-3-yl)-1H-isoquinoline |
|---|---|
| PubChem CID | 171980556 |
| Molecular Formula | C31H33FN2O2S |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-fluorophenyl)sulfonyl-1-(1H-indol-3-yl)-1H-isoquinoline |
| SMILES | CC(C)(C)c1cc(S(=O)(=O)N2C=Cc3ccccc3C2c2c[nH]c3ccccc23)cc(C(C)(C)C)c1F |
| InChI | InChI=1S/C31H33FN2O2S/c1-30(2,3)25-17-21(18-26(28(25)32)31(4,5)6)37(35,36)34-16-15-20-11-7-8-12-22(20)29(34)24-19-33-27-14-10-9-13-23(24)27/h7-19,29,33H,1-6H3 |
| InChIKey | FOJRMFXMLKQJDC-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |