C29H32N2O — CID 171980978
N-[(Z)-1-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethylideneamino]adamantane-1-carboxamide (PubChem CID 171980978) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[(Z)-1-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethylideneamino]adamantane-1-carboxamide.
| Compound Name | N-[(Z)-1-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171980978 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-[(Z)-1-(15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)ethylideneamino]adamantane-1-carboxamide |
| SMILES | C/C(=N/NC(=O)C12CC3CC(CC(C3)C1)C2)C1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C29H32N2O/c1-17(30-31-28(32)29-14-18-10-19(15-29)12-20(11-18)16-29)25-13-26-21-6-2-4-8-23(21)27(25)24-9-5-3-7-22(24)26/h2-9,18-20,25-27H,10-16H2,1H3,(H,31,32)/b30-17- |
| InChIKey | OUCBLMWABWTIGT-LQNQUEJISA-N |
| XLogP | 5.99 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|