C23H28N2O — CID 6025045
N-[(Z)-[(3E,5E)-6-phenylhexa-3,5-dien-2-ylidene]amino]adamantane-1-carboxamide (PubChem CID 6025045) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[(Z)-[(3E,5E)-6-phenylhexa-3,5-dien-2-ylidene]amino]adamantane-1-carboxamide.
| Compound Name | N-[(Z)-[(3E,5E)-6-phenylhexa-3,5-dien-2-ylidene]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 6025045 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[(Z)-[(3E,5E)-6-phenylhexa-3,5-dien-2-ylidene]amino]adamantane-1-carboxamide |
| SMILES | CC(/C=C/C=C/c1ccccc1)=N/NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H28N2O/c1-17(7-5-6-10-18-8-3-2-4-9-18)24-25-22(26)23-14-19-11-20(15-23)13-21(12-19)16-23/h2-10,19-21H,11-16H2,1H3,(H,25,26)/b7-5+,10-6+,24-17- |
| InChIKey | XGDSEPBIGOPGPA-UJZYNYLJSA-N |
| XLogP | 4.96 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|