C20H19ClN2O — CID 71952028
2-chloro-4-methyl-N-(6-phenylhexa-3,5-dien-2-ylideneamino)benzamide (PubChem CID 71952028) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(6-phenylhexa-3,5-dien-2-ylideneamino)benzamide.
| Compound Name | 2-chloro-4-methyl-N-(6-phenylhexa-3,5-dien-2-ylideneamino)benzamide |
|---|---|
| PubChem CID | 71952028 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-chloro-4-methyl-N-(6-phenylhexa-3,5-dien-2-ylideneamino)benzamide |
| SMILES | CC(C=CC=Cc1ccccc1)=NNC(=O)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C20H19ClN2O/c1-15-12-13-18(19(21)14-15)20(24)23-22-16(2)8-6-7-11-17-9-4-3-5-10-17/h3-14H,1-2H3,(H,23,24) |
| InChIKey | WSNHFWGFFQGLNO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|