C22H29N3OS — CID 171982630
2-[4-(dipropylamino)phenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 171982630) has the molecular formula C22H29N3OS and a molecular weight of 383.56 g/mol. Its IUPAC name is 2-[4-(dipropylamino)phenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-(dipropylamino)phenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 171982630 |
| Molecular Formula | C22H29N3OS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-[4-(dipropylamino)phenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCCN(CCC)c1ccc(C2NC(=O)c3c(sc4c3CCCC4)N2)cc1 |
| InChI | InChI=1S/C22H29N3OS/c1-3-13-25(14-4-2)16-11-9-15(10-12-16)20-23-21(26)19-17-7-5-6-8-18(17)27-22(19)24-20/h9-12,20,24H,3-8,13-14H2,1-2H3,(H,23,26) |
| InChIKey | KRLSULJZINLING-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |