C36H24N2O4 — CID 171983062
8-[[4-[4-[(8-carboxynaphthalen-1-yl)methylideneamino]phenyl]phenyl]iminomethyl]naphthalene-1-carboxylic acid (PubChem CID 171983062) has the molecular formula C36H24N2O4 and a molecular weight of 548.60 g/mol. Its IUPAC name is 8-[[4-[4-[(8-carboxynaphthalen-1-yl)methylideneamino]phenyl]phenyl]iminomethyl]naphthalene-1-carboxylic acid.
| Compound Name | 8-[[4-[4-[(8-carboxynaphthalen-1-yl)methylideneamino]phenyl]phenyl]iminomethyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 171983062 |
| Molecular Formula | C36H24N2O4 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 8-[[4-[4-[(8-carboxynaphthalen-1-yl)methylideneamino]phenyl]phenyl]iminomethyl]naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2cccc(/C=N/c3ccc(-c4ccc(/N=C/c5cccc6cccc(C(=O)O)c56)cc4)cc3)c12 |
| InChI | InChI=1S/C36H24N2O4/c39-35(40)31-11-3-7-25-5-1-9-27(33(25)31)21-37-29-17-13-23(14-18-29)24-15-19-30(20-16-24)38-22-28-10-2-6-26-8-4-12-32(34(26)28)36(41)42/h1-22H,(H,39,40)(H,41,42)/b37-21+,38-22+ |
| InChIKey | VAXVLIAHVKUXEM-DITNJDIQSA-N |
| XLogP | 8.56 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|