C20H28N2O4 — CID 171983096
ethyl (2E)-5,5-dimethyl-4-oxo-2-(4-phenylbutanoylhydrazinylidene)hexanoate (PubChem CID 171983096) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is ethyl (2E)-5,5-dimethyl-4-oxo-2-(4-phenylbutanoylhydrazinylidene)hexanoate.
| Compound Name | ethyl (2E)-5,5-dimethyl-4-oxo-2-(4-phenylbutanoylhydrazinylidene)hexanoate |
|---|---|
| PubChem CID | 171983096 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | ethyl (2E)-5,5-dimethyl-4-oxo-2-(4-phenylbutanoylhydrazinylidene)hexanoate |
| SMILES | CCOC(=O)/C(CC(=O)C(C)(C)C)=N/NC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C20H28N2O4/c1-5-26-19(25)16(14-17(23)20(2,3)4)21-22-18(24)13-9-12-15-10-7-6-8-11-15/h6-8,10-11H,5,9,12-14H2,1-4H3,(H,22,24)/b21-16+ |
| InChIKey | YYOUQMXOPSOOHK-LTGZKZEYSA-N |
| XLogP | 3.05 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|