About 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile
2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile (PubChem CID 171983323) has the molecular formula C15H9ClN4O3
and a molecular weight of 328.72 g/mol. Its IUPAC name is 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile |
| PubChem CID | 171983323 |
| Molecular Formula | C15H9ClN4O3 |
| Molecular Weight | 328.72 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile |
| SMILES | COc1nc(N)c(C#N)c(-c2cc3c(cc2Cl)OCO3)c1C#N |
| InChI | InChI=1S/C15H9ClN4O3/c1-21-15-9(5-18)13(8(4-17)14(19)20-15)7-2-11-12(3-10(7)16)23-6-22-11/h2-3H,6H2,1H3,(H2,19,20) |
| InChIKey | SVSYAGXHZPTCBM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile (CID 171983323) is 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile is COc1nc(N)c(C#N)c(-c2cc3c(cc2Cl)OCO3)c1C#N.
What is the InChIKey of 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile?
The InChIKey is SVSYAGXHZPTCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClN4O3/c1-21-15-9(5-18)13(8(4-17)14(19)20-15)7-2-11-12(3-10(7)16)23-6-22-11/h2-3H,6H2,1H3,(H2,19,20).
What are the key properties of 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile?
2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile has a molecular weight of 328.72 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(6-chloro-1,3-benzodioxol-5-yl)-6-methoxypyridine-3,5-dicarbonitrile is sourced from PubChem (CID 171983323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).