C7H5ClN4O — CID 171985660
3-amino-7-chloro-1,2,3-benzotriazin-4-one (PubChem CID 171985660) has the molecular formula C7H5ClN4O and a molecular weight of 196.60 g/mol. Its IUPAC name is 3-amino-7-chloro-1,2,3-benzotriazin-4-one.
| Compound Name | 3-amino-7-chloro-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 171985660 |
| Molecular Formula | C7H5ClN4O |
| Molecular Weight | 196.60 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 3-amino-7-chloro-1,2,3-benzotriazin-4-one |
| SMILES | Nn1nnc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C7H5ClN4O/c8-4-1-2-5-6(3-4)10-11-12(9)7(5)13/h1-3H,9H2 |
| InChIKey | WPKJTVWRDWJKKB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.60 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |