C8H5Cl2N3O — CID 606627
6-chloro-3-(chloromethyl)-1,2,3-benzotriazin-4-one (PubChem CID 606627) has the molecular formula C8H5Cl2N3O and a molecular weight of 230.05 g/mol. Its IUPAC name is 6-chloro-3-(chloromethyl)-1,2,3-benzotriazin-4-one.
| Compound Name | 6-chloro-3-(chloromethyl)-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 606627 |
| Molecular Formula | C8H5Cl2N3O |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 228.98 |
| IUPAC Name | 6-chloro-3-(chloromethyl)-1,2,3-benzotriazin-4-one |
| SMILES | O=c1c2cc(Cl)ccc2nnn1CCl |
| InChI | InChI=1S/C8H5Cl2N3O/c9-4-13-8(14)6-3-5(10)1-2-7(6)11-12-13/h1-3H,4H2 |
| InChIKey | OTMUZNJXZFQYDY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|