C15H10ClN3O2 — CID 2714491
3-[2-(4-chlorophenyl)-2-oxoethyl]-1,2,3-benzotriazin-4-one (PubChem CID 2714491) has the molecular formula C15H10ClN3O2 and a molecular weight of 299.72 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-2-oxoethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[2-(4-chlorophenyl)-2-oxoethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 2714491 |
| Molecular Formula | C15H10ClN3O2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-2-oxoethyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=C(Cn1nnc2ccccc2c1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClN3O2/c16-11-7-5-10(6-8-11)14(20)9-19-15(21)12-3-1-2-4-13(12)17-18-19/h1-8H,9H2 |
| InChIKey | HGFRJIFHAUXMQL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |