C21H14N4O2S — CID 38934577
3-(2-oxo-2-phenothiazin-10-ylethyl)-1,2,3-benzotriazin-4-one (PubChem CID 38934577) has the molecular formula C21H14N4O2S and a molecular weight of 386.44 g/mol. Its IUPAC name is 3-(2-oxo-2-phenothiazin-10-ylethyl)-1,2,3-benzotriazin-4-one.
| Compound Name | 3-(2-oxo-2-phenothiazin-10-ylethyl)-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 38934577 |
| Molecular Formula | C21H14N4O2S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 3-(2-oxo-2-phenothiazin-10-ylethyl)-1,2,3-benzotriazin-4-one |
| SMILES | O=C(Cn1nnc2ccccc2c1=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C21H14N4O2S/c26-20(13-24-21(27)14-7-1-2-8-15(14)22-23-24)25-16-9-3-5-11-18(16)28-19-12-6-4-10-17(19)25/h1-12H,13H2 |
| InChIKey | QRVIMNCCTVGRDL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |