2,6-dichloro-4-oxoquinazoline-3-carboxylic acid

C9H4Cl2N2O3 — CID 117264136

IUPAC2,6-dichloro-4-oxoquinazoline-3-carboxylic acid
SMILESO=C(O)n1c(Cl)nc2ccc(Cl)cc2c1=O
InChIInChI=1S/C9H4Cl2N2O3/c10-4-1-2-6-5(3-4)7(14)13(9(15)16)8(11)12-6/h1-3H,(H,15,16)
InChIKeyFBGCLBRCDMGPQV-UHFFFAOYSA-N
MW259.05 g/mol
LogP2.23
Rot. Bonds

About 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid

2,6-dichloro-4-oxoquinazoline-3-carboxylic acid (PubChem CID 117264136) has the molecular formula C9H4Cl2N2O3 and a molecular weight of 259.05 g/mol. Its IUPAC name is 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid.

Molecular Properties

Compound Name2,6-dichloro-4-oxoquinazoline-3-carboxylic acid
PubChem CID117264136
Molecular FormulaC9H4Cl2N2O3
Molecular Weight259.05 g/mol
Exact Mass257.96
IUPAC Name2,6-dichloro-4-oxoquinazoline-3-carboxylic acid
SMILESO=C(O)n1c(Cl)nc2ccc(Cl)cc2c1=O
InChIInChI=1S/C9H4Cl2N2O3/c10-4-1-2-6-5(3-4)7(14)13(9(15)16)8(11)12-6/h1-3H,(H,15,16)
InChIKeyFBGCLBRCDMGPQV-UHFFFAOYSA-N
XLogP2.23
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.05
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid?
The IUPAC name of 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid (CID 117264136) is 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid.
What is the SMILES notation for 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid?
The canonical SMILES for 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid is O=C(O)n1c(Cl)nc2ccc(Cl)cc2c1=O.
What is the InChIKey of 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid?
The InChIKey is FBGCLBRCDMGPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Cl2N2O3/c10-4-1-2-6-5(3-4)7(14)13(9(15)16)8(11)12-6/h1-3H,(H,15,16).
What are the key properties of 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid?
2,6-dichloro-4-oxoquinazoline-3-carboxylic acid has a molecular weight of 259.05 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-oxoquinazoline-3-carboxylic acid is sourced from PubChem (CID 117264136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).