C11H11Cl2N3O — CID 117264080
2,6-dichloro-3-[2-(methylamino)ethyl]quinazolin-4-one (PubChem CID 117264080) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. Its IUPAC name is 2,6-dichloro-3-[2-(methylamino)ethyl]quinazolin-4-one.
| Compound Name | 2,6-dichloro-3-[2-(methylamino)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 117264080 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2,6-dichloro-3-[2-(methylamino)ethyl]quinazolin-4-one |
| SMILES | CNCCn1c(Cl)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C11H11Cl2N3O/c1-14-4-5-16-10(17)8-6-7(12)2-3-9(8)15-11(16)13/h2-3,6,14H,4-5H2,1H3 |
| InChIKey | YLKSJQOPDDWSHP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |