C16H20ClN3O3 — CID 151688990
7-(6-chloro-2-methyl-4-oxoquinazolin-3-yl)-N-hydroxyheptanamide (PubChem CID 151688990) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 7-(6-chloro-2-methyl-4-oxoquinazolin-3-yl)-N-hydroxyheptanamide.
| Compound Name | 7-(6-chloro-2-methyl-4-oxoquinazolin-3-yl)-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 151688990 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 7-(6-chloro-2-methyl-4-oxoquinazolin-3-yl)-N-hydroxyheptanamide |
| SMILES | Cc1nc2ccc(Cl)cc2c(=O)n1CCCCCCC(=O)NO |
| InChI | InChI=1S/C16H20ClN3O3/c1-11-18-14-8-7-12(17)10-13(14)16(22)20(11)9-5-3-2-4-6-15(21)19-23/h7-8,10,23H,2-6,9H2,1H3,(H,19,21) |
| InChIKey | RCDPPADXJGHKRB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|