C21H29NO — CID 171986365
2-[(2,6-diethylphenyl)-phenylmethoxy]-N,N-dimethylethanamine (PubChem CID 171986365) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-[(2,6-diethylphenyl)-phenylmethoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[(2,6-diethylphenyl)-phenylmethoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 171986365 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-[(2,6-diethylphenyl)-phenylmethoxy]-N,N-dimethylethanamine |
| SMILES | CCc1cccc(CC)c1C(OCCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-5-17-13-10-14-18(6-2)20(17)21(23-16-15-22(3)4)19-11-8-7-9-12-19/h7-14,21H,5-6,15-16H2,1-4H3 |
| InChIKey | FADSBTXTAWBWRV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |