C17H20N2O6S — CID 171986570
methyl N-[bis(4-methoxyphenyl)methylsulfamoyl]carbamate (PubChem CID 171986570) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is methyl N-[bis(4-methoxyphenyl)methylsulfamoyl]carbamate.
| Compound Name | methyl N-[bis(4-methoxyphenyl)methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 171986570 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | methyl N-[bis(4-methoxyphenyl)methylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)NC(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H20N2O6S/c1-23-14-8-4-12(5-9-14)16(13-6-10-15(24-2)11-7-13)18-26(21,22)19-17(20)25-3/h4-11,16,18H,1-3H3,(H,19,20) |
| InChIKey | YHTZVPDJBUHHSV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |