C21H21ClN2O2 — CID 171987181
N-[(Z)-3-(4-chlorophenyl)-1-oxo-1-pyrrolidin-1-ylbut-2-en-2-yl]benzamide (PubChem CID 171987181) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is N-[(Z)-3-(4-chlorophenyl)-1-oxo-1-pyrrolidin-1-ylbut-2-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(4-chlorophenyl)-1-oxo-1-pyrrolidin-1-ylbut-2-en-2-yl]benzamide |
|---|---|
| PubChem CID | 171987181 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[(Z)-3-(4-chlorophenyl)-1-oxo-1-pyrrolidin-1-ylbut-2-en-2-yl]benzamide |
| SMILES | C/C(=C(/NC(=O)c1ccccc1)C(=O)N1CCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O2/c1-15(16-9-11-18(22)12-10-16)19(21(26)24-13-5-6-14-24)23-20(25)17-7-3-2-4-8-17/h2-4,7-12H,5-6,13-14H2,1H3,(H,23,25)/b19-15- |
| InChIKey | ZCEKRCSFEPEXNJ-CYVLTUHYSA-N |
| XLogP | 4.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|