C25H34N6 — CID 171987343
5-benzyl-8-[2-(dimethylamino)ethylamino]-6-piperidin-1-yl-3,4-dihydro-1H-2,7-naphthyridine-2-carbonitrile (PubChem CID 171987343) has the molecular formula C25H34N6 and a molecular weight of 418.59 g/mol. Its IUPAC name is 5-benzyl-8-[2-(dimethylamino)ethylamino]-6-piperidin-1-yl-3,4-dihydro-1H-2,7-naphthyridine-2-carbonitrile.
| Compound Name | 5-benzyl-8-[2-(dimethylamino)ethylamino]-6-piperidin-1-yl-3,4-dihydro-1H-2,7-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171987343 |
| Molecular Formula | C25H34N6 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 5-benzyl-8-[2-(dimethylamino)ethylamino]-6-piperidin-1-yl-3,4-dihydro-1H-2,7-naphthyridine-2-carbonitrile |
| SMILES | CN(C)CCNc1nc(N2CCCCC2)c(Cc2ccccc2)c2c1CN(C#N)CC2 |
| InChI | InChI=1S/C25H34N6/c1-29(2)16-12-27-24-23-18-30(19-26)15-11-21(23)22(17-20-9-5-3-6-10-20)25(28-24)31-13-7-4-8-14-31/h3,5-6,9-10H,4,7-8,11-18H2,1-2H3,(H,27,28) |
| InChIKey | JHBBDSHUBRGALS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|