C23H31N5O — CID 4886736
7-benzyl-3-(diethylamino)-1-(2-methoxyethylamino)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile (PubChem CID 4886736) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 7-benzyl-3-(diethylamino)-1-(2-methoxyethylamino)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile.
| Compound Name | 7-benzyl-3-(diethylamino)-1-(2-methoxyethylamino)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 4886736 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 7-benzyl-3-(diethylamino)-1-(2-methoxyethylamino)-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
| SMILES | CCN(CC)c1nc(NCCOC)c2c(c1C#N)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H31N5O/c1-4-28(5-2)23-20(15-24)19-11-13-27(16-18-9-7-6-8-10-18)17-21(19)22(26-23)25-12-14-29-3/h6-10H,4-5,11-14,16-17H2,1-3H3,(H,25,26) |
| InChIKey | NFMXBRWHDRRSNR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|