C20H18ClF2N5O — CID 166474993
3-chloro-1-(cyanomethylamino)-7-[[4-(2,2-difluoroethoxy)phenyl]methyl]-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile (PubChem CID 166474993) has the molecular formula C20H18ClF2N5O and a molecular weight of 417.85 g/mol. Its IUPAC name is 3-chloro-1-(cyanomethylamino)-7-[[4-(2,2-difluoroethoxy)phenyl]methyl]-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile.
| Compound Name | 3-chloro-1-(cyanomethylamino)-7-[[4-(2,2-difluoroethoxy)phenyl]methyl]-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 166474993 |
| Molecular Formula | C20H18ClF2N5O |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-chloro-1-(cyanomethylamino)-7-[[4-(2,2-difluoroethoxy)phenyl]methyl]-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
| SMILES | N#CCNc1nc(Cl)c(C#N)c2c1CN(Cc1ccc(OCC(F)F)cc1)CC2 |
| InChI | InChI=1S/C20H18ClF2N5O/c21-19-16(9-25)15-5-8-28(11-17(15)20(27-19)26-7-6-24)10-13-1-3-14(4-2-13)29-12-18(22)23/h1-4,18H,5,7-8,10-12H2,(H,26,27) |
| InChIKey | CJURVYSGQYRZBJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|